What is the pKa of hexanoic acid?
pKa1 4.8
Structure for FDB013897 (Hexanoic acid)
| Property | Value | Reference |
|---|---|---|
| Density | d154 0.93 | DFC |
| Experimental logP | 1.92 | HANSCH,C ET AL. (1995) |
| Experimental pKa | pKa1 4.8 (25°) | DFC |
| Experimental Water Solubility | 10.3 mg/mL at 25 oC | YALKOWSKY,SH & HE,Y (2003) |
What is the PH of hexanoic acid?
Hexanoic acid for synthesis. CAS 142-62-1, pH 4 (1 g/l, H₂O, 20 °C)….Pricing & Availability.
| Description | |
|---|---|
| Catalogue Number | 800198 |
| Synonyms | Caproic acid |
What is the PH of cyclohexanol?
16
Cyclohexanol
| Names | |
|---|---|
| Acidity (pKa) | 16 |
| Magnetic susceptibility (χ) | -73.40·10−6 cm3/mol |
| Refractive index (nD) | 1.4641 |
| Viscosity | 41.07 mPa·s (30 °C) |
Is cyclohexanol an alkane?
1 Answer. It is an alcohol.
What functional group is cyclohexanol?
ketone functional group
Cyclohexanone is the organic compound with the formula (CH2)5CO. The molecule consists of six-carbon cyclic molecule with a ketone functional group….CHEBI:17854 – cyclohexanone.
| ChEBI Name | cyclohexanone |
|---|---|
| Definition | A cyclic ketone that consists of cyclohexane bearing a single oxo substituent. |
What is the Iupac name of hexanoic acid?
| IUPAC Name | hexanoic acid |
|---|---|
| Alternative Names | Caproic acid n-Hexanoic acid |
| Molecular Formula | C6H12O2 |
| Molar Mass | 116.16 g/mol |
| InChI | InChI=1S/C6H12O2/c1-2-3-4-5-6(7)8/h2-5H2,1H3,(H,7,8) |