What are the two isomers of cinnamic acid?
Cinnamic acid is 3-phenylpropenoic acid. Each alkene carbon has two different groups, so the molecule can exist as E/Z isomers. ( E )-Cinnamic acid has the phenyl and COOH groups on opposite sides of the double bond. In ( Z )-cinnamic acid, the phenyl and COOH groups are on the same side of the double bond.
What is cinnamic acid derivatives?
The common cinnamic acid derivatives include p-coumaric acid, caffeic acid, and ferulic acid. Chokeberry is abundant in hydroxycinnamic acid derivatives represented mainly by chlorogenic acid and neochlorogenic acid. Ellagic acid and its conjugates form the majority of phenolic acids in red raspberries.
Can cinnamic acid exist as an geometrical isomer?
Because the presence of a rigid double bond in its molecule structure, cinnamic acids can exist as two different geometric isomers, the E-form and Z-form.
What is the functional group of Cinnamic acid?
Cinnamic acid is obtained from cinnamon bark. Its structure is composed of a benzene ring, an alkene double bond and an acrylic acid functional group making it possible to modify the aforemention…
What is the Iupac name of Cinnamic acid?
| IUPAC Name | (E)-3-phenylprop-2-enoic acid |
|---|---|
| Alternative Names | CINNAMIC ACID TRANS-CINNAMIC ACID (E)-Cinnamic acid 3-Phenylacrylic acid trans-3-Phenylacrylic acid |
| Molecular Formula | C9H8O2 |
| Molar Mass | 148.161 g/mol |
| InChI | InChI=1S/C9H8O2/c10-9(11)7-6-8-4-2-1-3-5-8/h1-7H,(H,10,11)/b7-6+ |
What is the Iupac name of cinnamic acid?
What is the density of cinnamic acid?
1.25 g/cm³Cinnamic acid / Density
What is the functional group of cinnamic acid?
Is cinnamic acid saturated?
Cinnamic acid, an unsaturated carboxylic acid, is the chief constituent of the fragrant balsamic resin storax.
https://www.youtube.com/watch?v=UUt2VgIKF4U