What is the name for C2O5?
Dicarbon Pentoxide C2O5 Molecular Weight — EndMemo.
What is the chemical name of C6H12O5?
| IUPAC Name | (3R,4R,5R,6S)-6-methyloxane-2,3,4,5-tetrol |
|---|---|
| Molecular Formula | C6H12O5 |
| Molar Mass | 164.157 g/mol |
| InChI | InChI=1S/C6H12O5/c1-2-3(7)4(8)5(9)6(10)11-2/h2-10H,1H3/t2-,3-,4+,5+,6?/m0/s1 |
| InChI Key | SHZGCJCMOBCMKK-JFNONXLTSA-N |
What is the chemical name of c2h2o2?
Acetylenediol ethynediol
Acetylenediol
| PubChem CID | 9942115 |
|---|---|
| Molecular Formula | C2H2O2 |
| Synonyms | Acetylenediol ethynediol dihydroxyacetylene Ethyne-1,2-diol acetylene diol More… |
| Molecular Weight | 58.04 |
| Dates | Modify 2022-04-09 Create 2006-10-25 |
What is the chemical name for H2NO2?
Nitryl ion
Nitryl ion | H2NO2 | ChemSpider.
What is the name of c2o4?
ethanedioateOxalate / IUPAC ID
What is the chemical name of c6h10o5?
diethyl pyrocarbonate
Diethyl pyrocarbonate
| PubChem CID | 3051 |
|---|---|
| Chemical Safety | Laboratory Chemical Safety Summary (LCSS) Datasheet |
| Molecular Formula | C6H10O5 |
| Synonyms | diethyl pyrocarbonate 1609-47-8 Diethyl dicarbonate Diethyl oxydiformate Baycovin More… |
| Molecular Weight | 162.14 |
What is the formula of Rhamnose?
C6H12O5Rhamnose / Formula
What is the chemical name of glyoxal?
oxaldehyde
| IUPAC Name | oxaldehyde |
|---|---|
| Molecular Formula | C2H2O2 |
| Molar Mass | 58.036 g/mol |
| InChI | InChI=1S/C2H2O2/c3-1-2-4/h1-2H |
| InChI Key | LEQAOMBKQFMDFZ-UHFFFAOYSA-N |
What is the name of HNO?
Nitroxyl
Nitroxyl (common name) or azanone (IUPAC name) is the chemical compound HNO. It is well known in the gas phase. Nitroxyl can be formed as a short-lived intermediate in the solution phase. The conjugate base, NO−, nitroxide anion, is the reduced form of nitric oxide (NO) and is isoelectronic with dioxygen.
What is hno3 called in chemistry?
nitric acid
nitric acid, (HNO3), colourless, fuming, and highly corrosive liquid (freezing point −42 °C [−44 °F], boiling point 83 °C [181 °F]) that is a common laboratory reagent and an important industrial chemical for the manufacture of fertilizers and explosives.