What is the formula of resorcinol?

What is the formula of resorcinol?

C6H6O2Resorcinol / Formula

What is the chemical name of resorcinol?

Benzene-1,3-diolResorcinol / IUPAC ID

How is resorcinol formed?

resorcinol, also called m-dihydroxybenzene, phenolic compound used in the manufacture of resins, plastics, dyes, medicine, and numerous other organic chemical compounds. It is produced in large quantities by sulfonating benzene with fuming sulfuric acid and fusing the resulting benzenedisulfonic acid with caustic soda.

What is the functional group of resorcinol?

It is also known as Resorcin or m-Dihydroxybenzene. It is a 1,3-isomer of benzenediol. It is a benzenediol that is benzene dihydroxylated at position number 3 and 1. It functions as a sensitizer and an erythropoietin inhibitor.

How do you make resorcinol solution?

A process for the preparation of resorcinol from diisopropylbenzene includes the steps of oxidizing m-diisopropylbenzene under anhydrous, non-alkaline conditions with oxygen, extracting m-diisopropylbenzene dihydroperoxide and m-diisopropylbenzene hydroxyhydroperoxide with dilute sodium hydroxide, re-extracting with an …

What is the Iupac name of Phloroglucinol?

IUPAC Name benzene-1,3,5-triol
Alternative Names phloroglucinol 1,3,5-trihydroxybenzene 1,3,5-benzenetriol Benzene-1,3,5-triol
Molecular Formula C6H6O3
Molar Mass 126.111 g/mol
InChI InChI=1S/C6H6O3/c7-4-1-5(8)3-6(9)2-4/h1-3,7-9H

What is the Iupac name of catechol?

benzene-1,2-diol

IUPAC Name benzene-1,2-diol
Alternative Names pyrocatechol catechol 1,2-dihydroxybenzene 1,2-benzenediol benzene-1,2-diol
Molecular Formula C6H6O2
Molar Mass 110.112 g/mol
InChI InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H

What is resorcinol method?

Abstract. A method using seliwanoff reaction is proposed for the determination of fructose in the amylose of mustard leaves. Fructose reacts with resorcinol forming a red compound with a maximum absorption at 473 nm. The calibration curve is linear over the range of 0-83 micrograms.

What are solutions in chemistry?

solution, in chemistry, a homogenous mixture of two or more substances in relative amounts that can be varied continuously up to what is called the limit of solubility. The term solution is commonly applied to the liquid state of matter, but solutions of gases and solids are possible.

What is the structure of phloroglucinol?

Phloroglucinol is a polyphenolic compound that chemical structure includes an aromatic phenyl ring with three hydroxyl groups.

Which of the following is phloroglucinol?

4-chloro-1,3-dimethylbenzene.